C46H47N3O7 — CID 6700786
benzyl N-[1-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6700786) has the molecular formula C46H47N3O7 and a molecular weight of 753.90 g/mol. Its IUPAC name is benzyl N-[1-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6700786 |
| Molecular Formula | C46H47N3O7 |
| Molecular Weight | 753.90 g/mol |
| Exact Mass | 753.34 |
| IUPAC Name | benzyl N-[1-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C[C@@H](c1ccccc1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CN3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)cc2)O1 |
| InChI | InChI=1S/C46H47N3O7/c1-31(34-13-7-4-8-14-34)48(2)28-39-25-42(36-19-17-32(29-50)18-20-36)56-45(55-39)37-23-21-35(22-24-37)40-16-10-9-15-38(40)27-49-43(51)26-41(44(49)52)47-46(53)54-30-33-11-5-3-6-12-33/h3-24,31,39,41-42,45,50H,25-30H2,1-2H3,(H,47,53)/t31-,39+,41?,42-,45-/m0/s1 |
| InChIKey | ZLLIHJKRXSFDFI-DRTKPDAYSA-N |
| XLogP | 7.64 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.90 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|