C44H49N3O7 — CID 6699689
benzyl N-[1-[[2-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6699689) has the molecular formula C44H49N3O7 and a molecular weight of 731.89 g/mol. Its IUPAC name is benzyl N-[1-[[2-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[2-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6699689 |
| Molecular Formula | C44H49N3O7 |
| Molecular Weight | 731.89 g/mol |
| Exact Mass | 731.36 |
| IUPAC Name | benzyl N-[1-[[2-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1CC(=O)N(Cc2ccccc2-c2ccc([C@H]3O[C@@H](CN4CCCCCCC4)C[C@@H](c4ccc(CO)cc4)O3)cc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C44H49N3O7/c48-29-31-15-17-34(18-16-31)40-25-37(28-46-23-9-2-1-3-10-24-46)53-43(54-40)35-21-19-33(20-22-35)38-14-8-7-13-36(38)27-47-41(49)26-39(42(47)50)45-44(51)52-30-32-11-5-4-6-12-32/h4-8,11-22,37,39-40,43,48H,1-3,9-10,23-30H2,(H,45,51)/t37-,39?,40+,43+/m1/s1 |
| InChIKey | QCGNGVIDFPGTAO-VNUDPNJHSA-N |
| XLogP | 7.21 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.89 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|