C38H43N3O9 — CID 6701182
benzyl N-[1-[[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6701182) has the molecular formula C38H43N3O9 and a molecular weight of 685.77 g/mol. Its IUPAC name is benzyl N-[1-[[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6701182 |
| Molecular Formula | C38H43N3O9 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | benzyl N-[1-[[4-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1CC(=O)N(Cc2ccc([C@H]3O[C@@H](CN4CCC5(CC4)OCCO5)C[C@@H](c4ccc(CO)cc4)O3)cc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H43N3O9/c42-24-27-8-10-29(11-9-27)33-20-31(23-40-16-14-38(15-17-40)47-18-19-48-38)49-36(50-33)30-12-6-26(7-13-30)22-41-34(43)21-32(35(41)44)39-37(45)46-25-28-4-2-1-3-5-28/h1-13,31-33,36,42H,14-25H2,(H,39,45)/t31-,32?,33+,36+/m1/s1 |
| InChIKey | MUCQFKCWVYDFQB-JOQKKFQASA-N |
| XLogP | 4.12 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|