C53H58N4O5 — CID 6675121
N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 6675121) has the molecular formula C53H58N4O5 and a molecular weight of 831.07 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 6675121 |
| Molecular Formula | C53H58N4O5 |
| Molecular Weight | 831.07 g/mol |
| Exact Mass | 830.44 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN(Cc3ccccc3)Cc3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C53H58N4O5/c54-48-21-13-14-22-49(48)56-52(60)24-10-2-1-9-23-51(59)55-34-45-19-11-12-20-47(45)42-29-31-44(32-30-42)53-61-46(33-50(62-53)43-27-25-41(38-58)26-28-43)37-57(35-39-15-5-3-6-16-39)36-40-17-7-4-8-18-40/h3-8,11-22,25-32,46,50,53,58H,1-2,9-10,23-24,33-38,54H2,(H,55,59)(H,56,60)/t46-,50+,53+/m1/s1 |
| InChIKey | UTBKVVODXWUORQ-DNNFZSTKSA-N |
| XLogP | 10.27 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.07 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|