C34H48N2O6 — CID 6673007
8-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6673007) has the molecular formula C34H48N2O6 and a molecular weight of 580.77 g/mol. Its IUPAC name is 8-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6673007 |
| Molecular Formula | C34H48N2O6 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 8-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NCc1ccc([C@H]2O[C@@H](CN3CCCCCCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C34H48N2O6/c37-25-27-14-16-28(17-15-27)31-22-30(24-36-20-8-4-1-5-9-21-36)41-34(42-31)29-18-12-26(13-19-29)23-35-32(38)10-6-2-3-7-11-33(39)40/h12-19,30-31,34,37H,1-11,20-25H2,(H,35,38)(H,39,40)/t30-,31+,34+/m1/s1 |
| InChIKey | WUDCZNHGUZHZLX-JGBIIJINSA-N |
| XLogP | 6.03 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|