C33H46N4O6 — CID 6677742
N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6677742) has the molecular formula C33H46N4O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6677742 |
| Molecular Formula | C33H46N4O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccc([C@@H]2O[C@H](CN3CCC[C@H]3CN3CCCC3)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C33H46N4O6/c38-23-24-9-11-25(12-10-24)30-20-29(22-37-19-5-6-28(37)21-36-17-3-4-18-36)42-33(43-30)26-13-15-27(16-14-26)34-31(39)7-1-2-8-32(40)35-41/h9-16,28-30,33,38,41H,1-8,17-23H2,(H,34,39)(H,35,40)/t28-,29-,30+,33+/m0/s1 |
| InChIKey | QQWHMBHZJMRKLW-HBRHGHBMSA-N |
| XLogP | 4.29 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|