C35H44N4O6 — CID 6672703
N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6672703) has the molecular formula C35H44N4O6 and a molecular weight of 616.76 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6672703 |
| Molecular Formula | C35H44N4O6 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1ccc([C@H]2O[C@@H](CN3CCC[C@H]3CO)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C35H44N4O6/c36-30-7-1-2-8-31(30)38-34(43)10-4-3-9-33(42)37-27-17-15-26(16-18-27)35-44-29(21-39-19-5-6-28(39)23-41)20-32(45-35)25-13-11-24(22-40)12-14-25/h1-2,7-8,11-18,28-29,32,35,40-41H,3-6,9-10,19-23,36H2,(H,37,42)(H,38,43)/t28-,29+,32-,35-/m0/s1 |
| InChIKey | WNQPZIZZAWEVOK-PGKIGNJSSA-N |
| XLogP | 4.90 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|