C39H50N4O7 — CID 4551625
tert-butyl 1-[[2-[4-[[6-(2-aminoanilino)-6-oxohexanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 4551625) has the molecular formula C39H50N4O7 and a molecular weight of 686.85 g/mol. Its IUPAC name is tert-butyl 1-[[2-[4-[[6-(2-aminoanilino)-6-oxohexanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-[[2-[4-[[6-(2-aminoanilino)-6-oxohexanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 4551625 |
| Molecular Formula | C39H50N4O7 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | tert-butyl 1-[[2-[4-[[6-(2-aminoanilino)-6-oxohexanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN1CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)CCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C39H50N4O7/c1-39(2,3)50-37(47)33-11-8-22-43(33)24-30-23-34(27-16-14-26(25-44)15-17-27)49-38(48-30)28-18-20-29(21-19-28)41-35(45)12-6-7-13-36(46)42-32-10-5-4-9-31(32)40/h4-5,9-10,14-21,30,33-34,38,44H,6-8,11-13,22-25,40H2,1-3H3,(H,41,45)(H,42,46) |
| InChIKey | LSHOLYIYNZNBHN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|