C41H54N4O7 — CID 6678397
tert-butyl (2S)-1-[[(2S,4S,6R)-2-[4-[[8-(2-aminoanilino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6678397) has the molecular formula C41H54N4O7 and a molecular weight of 714.90 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2S,4S,6R)-2-[4-[[8-(2-aminoanilino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2S,4S,6R)-2-[4-[[8-(2-aminoanilino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6678397 |
| Molecular Formula | C41H54N4O7 |
| Molecular Weight | 714.90 g/mol |
| Exact Mass | 714.40 |
| IUPAC Name | tert-butyl (2S)-1-[[(2S,4S,6R)-2-[4-[[8-(2-aminoanilino)-8-oxooctanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C41H54N4O7/c1-41(2,3)52-39(49)35-13-10-24-45(35)26-32-25-36(29-18-16-28(27-46)17-19-29)51-40(50-32)30-20-22-31(23-21-30)43-37(47)14-6-4-5-7-15-38(48)44-34-12-9-8-11-33(34)42/h8-9,11-12,16-23,32,35-36,40,46H,4-7,10,13-15,24-27,42H2,1-3H3,(H,43,47)(H,44,48)/t32-,35-,36+,40+/m0/s1 |
| InChIKey | UOXIVRIVPYYPRA-IYTXQVNNSA-N |
| XLogP | 7.03 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|