C38H50N4O6 — CID 3981058
N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 3981058) has the molecular formula C38H50N4O6 and a molecular weight of 658.84 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 3981058 |
| Molecular Formula | C38H50N4O6 |
| Molecular Weight | 658.84 g/mol |
| Exact Mass | 658.37 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | COCC1CCCN1CC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C38H50N4O6/c1-46-26-31-12-9-21-42(31)24-32-23-35(28-19-17-27(25-43)18-20-28)48-38(47-32)29-10-8-11-30(22-29)40-36(44)15-4-2-3-5-16-37(45)41-34-14-7-6-13-33(34)39/h6-8,10-11,13-14,17-20,22,31-32,35,38,43H,2-5,9,12,15-16,21,23-26,39H2,1H3,(H,40,44)(H,41,45) |
| InChIKey | CACLLGHALDKHSA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.84 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|