C32H45N3O7 — CID 6676800
N'-hydroxy-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6676800) has the molecular formula C32H45N3O7 and a molecular weight of 583.73 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6676800 |
| Molecular Formula | C32H45N3O7 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | N'-hydroxy-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | COC[C@@H]1CCCN1C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)CCCCCCC(=O)NO)c2)O1 |
| InChI | InChI=1S/C32H45N3O7/c1-40-22-27-10-7-17-35(27)20-28-19-29(24-15-13-23(21-36)14-16-24)42-32(41-28)25-8-6-9-26(18-25)33-30(37)11-4-2-3-5-12-31(38)34-39/h6,8-9,13-16,18,27-29,32,36,39H,2-5,7,10-12,17,19-22H2,1H3,(H,33,37)(H,34,38)/t27-,28-,29+,32+/m0/s1 |
| InChIKey | WFTPOPAMMXQDPT-ZUDRNWICSA-N |
| XLogP | 4.62 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|