C31H43N3O7 — CID 3981885
N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide (PubChem CID 3981885) has the molecular formula C31H43N3O7 and a molecular weight of 569.70 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 3981885 |
| Molecular Formula | C31H43N3O7 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
| SMILES | COCC1CCCN1CC1CC(c2ccc(CO)cc2)OC(c2ccc(CNC(=O)CCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C31H43N3O7/c1-39-21-26-5-4-16-34(26)19-27-17-28(24-12-10-23(20-35)11-13-24)41-31(40-27)25-14-8-22(9-15-25)18-32-29(36)6-2-3-7-30(37)33-38/h8-15,26-28,31,35,38H,2-7,16-21H2,1H3,(H,32,36)(H,33,37) |
| InChIKey | OTLSGIPWRWNBMU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|