C37H48N4O6 — CID 4650364
N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide (PubChem CID 4650364) has the molecular formula C37H48N4O6 and a molecular weight of 644.81 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 4650364 |
| Molecular Formula | C37H48N4O6 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
| SMILES | COCC1CCCN1CC1CC(c2ccc(CO)cc2)OC(c2ccc(CNC(=O)CCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C37H48N4O6/c1-45-25-30-7-6-20-41(30)23-31-21-34(28-16-14-27(24-42)15-17-28)47-37(46-31)29-18-12-26(13-19-29)22-39-35(43)10-4-5-11-36(44)40-33-9-3-2-8-32(33)38/h2-3,8-9,12-19,30-31,34,37,42H,4-7,10-11,20-25,38H2,1H3,(H,39,43)(H,40,44) |
| InChIKey | MELUTIVLAYTUCO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|