C38H43N3O6 — CID 6678678
N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide (PubChem CID 6678678) has the molecular formula C38H43N3O6 and a molecular weight of 637.78 g/mol. Its IUPAC name is N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 6678678 |
| Molecular Formula | C38H43N3O6 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | N-[4-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccc([C@@H]2O[C@H](CN(Cc3ccccc3)Cc3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C38H43N3O6/c42-27-30-15-17-31(18-16-30)35-23-34(26-41(24-28-9-3-1-4-10-28)25-29-11-5-2-6-12-29)46-38(47-35)32-19-21-33(22-20-32)39-36(43)13-7-8-14-37(44)40-45/h1-6,9-12,15-22,34-35,38,42,45H,7-8,13-14,23-27H2,(H,39,43)(H,40,44)/t34-,35+,38+/m0/s1 |
| InChIKey | RHXJSZXBNRIHDN-FACBKIGESA-N |
| XLogP | 6.43 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|