C38H42N2O6 — CID 6678665
6-[3-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid (PubChem CID 6678665) has the molecular formula C38H42N2O6 and a molecular weight of 622.76 g/mol. Its IUPAC name is 6-[3-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid.
| Compound Name | 6-[3-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6678665 |
| Molecular Formula | C38H42N2O6 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 6-[3-[(2S,4S,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1cccc([C@@H]2O[C@H](CN(Cc3ccccc3)Cc3ccccc3)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C38H42N2O6/c41-27-30-18-20-31(21-19-30)35-23-34(26-40(24-28-10-3-1-4-11-28)25-29-12-5-2-6-13-29)45-38(46-35)32-14-9-15-33(22-32)39-36(42)16-7-8-17-37(43)44/h1-6,9-15,18-22,34-35,38,41H,7-8,16-17,23-27H2,(H,39,42)(H,43,44)/t34-,35+,38+/m0/s1 |
| InChIKey | GPJUULOKFXSGIF-FACBKIGESA-N |
| XLogP | 7.01 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|