C28H38N2O7S — CID 6675957
N'-hydroxy-N-[[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide (PubChem CID 6675957) has the molecular formula C28H38N2O7S and a molecular weight of 546.69 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6675957 |
| Molecular Formula | C28H38N2O7S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | N'-hydroxy-N-[[4-[(2S,4S,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccc([C@@H]2O[C@H](CSCCO)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C28H38N2O7S/c31-14-15-38-19-24-16-25(22-10-8-21(18-32)9-11-22)37-28(36-24)23-12-6-20(7-13-23)17-29-26(33)4-2-1-3-5-27(34)30-35/h6-13,24-25,28,31-32,35H,1-5,14-19H2,(H,29,33)(H,30,34)/t24-,25+,28+/m0/s1 |
| InChIKey | TWXNHFZNNBZXIQ-BXTSTYNKSA-N |
| XLogP | 3.52 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|