C25H31NO7S — CID 3577030
5-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 3577030) has the molecular formula C25H31NO7S and a molecular weight of 489.59 g/mol. Its IUPAC name is 5-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 3577030 |
| Molecular Formula | C25H31NO7S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 5-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(C2OC(CSCCO)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C25H31NO7S/c27-12-13-34-16-21-14-22(18-6-4-17(15-28)5-7-18)33-25(32-21)19-8-10-20(11-9-19)26-23(29)2-1-3-24(30)31/h4-11,21-22,25,27-28H,1-3,12-16H2,(H,26,29)(H,30,31) |
| InChIKey | KCJQFGWFRMFOMM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|