C29H35N3O6S2 — CID 6673643
8-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid (PubChem CID 6673643) has the molecular formula C29H35N3O6S2 and a molecular weight of 585.75 g/mol. Its IUPAC name is 8-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid.
| Compound Name | 8-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6673643 |
| Molecular Formula | C29H35N3O6S2 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 8-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
| SMILES | Cc1nnc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(NC(=O)CCCCCCC(=O)O)cc3)O2)s1 |
| InChI | InChI=1S/C29H35N3O6S2/c1-19-31-32-29(40-19)39-18-24-16-25(21-10-8-20(17-33)9-11-21)38-28(37-24)22-12-14-23(15-13-22)30-26(34)6-4-2-3-5-7-27(35)36/h8-15,24-25,28,33H,2-7,16-18H2,1H3,(H,30,34)(H,35,36)/t24-,25+,28+/m1/s1 |
| InChIKey | CPGOEKJWYYGFNQ-QQNWGBJXSA-N |
| XLogP | 6.04 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|