C37H38N4O5S2 — CID 6678247
N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6678247) has the molecular formula C37H38N4O5S2 and a molecular weight of 682.87 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6678247 |
| Molecular Formula | C37H38N4O5S2 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1ccc([C@@H]2O[C@H](CSc3nc4ccccc4s3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C37H38N4O5S2/c38-29-7-1-2-8-30(29)40-35(44)12-6-5-11-34(43)39-27-19-17-26(18-20-27)36-45-28(21-32(46-36)25-15-13-24(22-42)14-16-25)23-47-37-41-31-9-3-4-10-33(31)48-37/h1-4,7-10,13-20,28,32,36,42H,5-6,11-12,21-23,38H2,(H,39,43)(H,40,44)/t28-,32+,36+/m0/s1 |
| InChIKey | MUDBRZWXPDBKLR-HVMFECAZSA-N |
| XLogP | 7.85 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|