C33H36N2O6S2 — CID 6674639
8-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid (PubChem CID 6674639) has the molecular formula C33H36N2O6S2 and a molecular weight of 620.79 g/mol. Its IUPAC name is 8-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid.
| Compound Name | 8-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6674639 |
| Molecular Formula | C33H36N2O6S2 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 8-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)Nc1cccc([C@H]2O[C@@H](CSc3nc4ccccc4s3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C33H36N2O6S2/c36-20-22-14-16-23(17-15-22)28-19-26(21-42-33-35-27-10-5-6-11-29(27)43-33)40-32(41-28)24-8-7-9-25(18-24)34-30(37)12-3-1-2-4-13-31(38)39/h5-11,14-18,26,28,32,36H,1-4,12-13,19-21H2,(H,34,37)(H,38,39)/t26-,28+,32+/m1/s1 |
| InChIKey | CPJUPSFHKGVVCO-LNGZGTQPSA-N |
| XLogP | 7.49 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|