C37H36N2O6S2 — CID 6678290
5-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6678290) has the molecular formula C37H36N2O6S2 and a molecular weight of 668.84 g/mol. Its IUPAC name is 5-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6678290 |
| Molecular Formula | C37H36N2O6S2 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | 5-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4nc5ccccc5s4)C[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C37H36N2O6S2/c40-22-24-14-16-26(17-15-24)32-20-30(23-46-37-39-31-10-1-2-11-33(31)47-37)44-36(45-32)29-9-4-8-28(19-29)27-7-3-6-25(18-27)21-38-34(41)12-5-13-35(42)43/h1-4,6-11,14-19,30,32,36,40H,5,12-13,20-23H2,(H,38,41)(H,42,43)/t30-,32+,36+/m0/s1 |
| InChIKey | NCCPJYOHGGIWGA-GXXFZFQXSA-N |
| XLogP | 7.66 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |