C30H35N3O5S — CID 23654040
N'-hydroxy-N-[4-[2-phenyl-6-(pyridin-4-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]octanediamide (PubChem CID 23654040) has the molecular formula C30H35N3O5S and a molecular weight of 549.69 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[2-phenyl-6-(pyridin-4-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-[2-phenyl-6-(pyridin-4-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 23654040 |
| Molecular Formula | C30H35N3O5S |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | N'-hydroxy-N-[4-[2-phenyl-6-(pyridin-4-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(C2CC(CSc3ccncc3)OC(c3ccccc3)O2)cc1)NO |
| InChI | InChI=1S/C30H35N3O5S/c34-28(10-6-1-2-7-11-29(35)33-36)32-24-14-12-22(13-15-24)27-20-25(21-39-26-16-18-31-19-17-26)37-30(38-27)23-8-4-3-5-9-23/h3-5,8-9,12-19,25,27,30,36H,1-2,6-7,10-11,20-21H2,(H,32,34)(H,33,35) |
| InChIKey | MWARYRGUOXYFNF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|