C40H36F5N5O4 — CID 6696406
2,3,4,5,6-pentafluoro-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6696406) has the molecular formula C40H36F5N5O4 and a molecular weight of 745.75 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6696406 |
| Molecular Formula | C40H36F5N5O4 |
| Molecular Weight | 745.75 g/mol |
| Exact Mass | 745.27 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(-c2cccc([C@@H]3O[C@H](CN4CCN(c5ncccn5)CC4)C[C@H](c4ccc(CO)cc4)O3)c2)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C40H36F5N5O4/c41-33-32(34(42)36(44)37(45)35(33)43)38(52)48-21-25-4-1-5-27(18-25)28-6-2-7-29(19-28)39-53-30(20-31(54-39)26-10-8-24(23-51)9-11-26)22-49-14-16-50(17-15-49)40-46-12-3-13-47-40/h1-13,18-19,30-31,39,51H,14-17,20-23H2,(H,48,52)/t30-,31+,39+/m0/s1 |
| InChIKey | SSYHCWUPPCTSCU-QGVLQDEZSA-N |
| XLogP | 6.63 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.75 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|