C34H32F5N5O4 — CID 6696340
2,3,4,5,6-pentafluoro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide (PubChem CID 6696340) has the molecular formula C34H32F5N5O4 and a molecular weight of 669.65 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6696340 |
| Molecular Formula | C34H32F5N5O4 |
| Molecular Weight | 669.65 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc([C@@H]2O[C@H](CN3CCN(c4ncccn4)CC3)C[C@H](c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C34H32F5N5O4/c35-27-26(28(36)30(38)31(39)29(27)37)32(46)42-17-20-2-8-23(9-3-20)33-47-24(16-25(48-33)22-6-4-21(19-45)5-7-22)18-43-12-14-44(15-13-43)34-40-10-1-11-41-34/h1-11,24-25,33,45H,12-19H2,(H,42,46)/t24-,25+,33+/m0/s1 |
| InChIKey | ZDYHTBSFEMHCFT-JQASONJCSA-N |
| XLogP | 4.96 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|