C35H38F5N3O4 — CID 3545958
2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide (PubChem CID 3545958) has the molecular formula C35H38F5N3O4 and a molecular weight of 659.70 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 3545958 |
| Molecular Formula | C35H38F5N3O4 |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C2OC(CN3CCCC3CN3CCCC3)CC(c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C35H38F5N3O4/c36-29-28(30(37)32(39)33(40)31(29)38)34(45)41-17-21-5-11-24(12-6-21)35-46-26(16-27(47-35)23-9-7-22(20-44)8-10-23)19-43-15-3-4-25(43)18-42-13-1-2-14-42/h5-12,25-27,35,44H,1-4,13-20H2,(H,41,45) |
| InChIKey | XHXXRUJYEGUQRX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|