C30H38Cl3N3O4 — CID 6695896
2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6695896) has the molecular formula C30H38Cl3N3O4 and a molecular weight of 611.01 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6695896 |
| Molecular Formula | C30H38Cl3N3O4 |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccc([C@@H]2O[C@H](CN3CCC[C@H]3CN3CCCC3)C[C@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H38Cl3N3O4/c31-30(32,33)29(38)34-17-21-5-11-24(12-6-21)28-39-26(16-27(40-28)23-9-7-22(20-37)8-10-23)19-36-15-3-4-25(36)18-35-13-1-2-14-35/h5-12,25-28,37H,1-4,13-20H2,(H,34,38)/t25-,26-,27+,28+/m0/s1 |
| InChIKey | ZLYJBYQPQVFJBC-YVHASNINSA-N |
| XLogP | 5.27 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|