C36H42Cl3N3O4 — CID 6701434
2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6701434) has the molecular formula C36H42Cl3N3O4 and a molecular weight of 687.11 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6701434 |
| Molecular Formula | C36H42Cl3N3O4 |
| Molecular Weight | 687.11 g/mol |
| Exact Mass | 685.22 |
| IUPAC Name | 2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CCC[C@H]3CN3CCCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H42Cl3N3O4/c37-36(38,39)35(44)40-21-29-6-1-2-8-32(29)26-13-15-28(16-14-26)34-45-31(20-33(46-34)27-11-9-25(24-43)10-12-27)23-42-19-5-7-30(42)22-41-17-3-4-18-41/h1-2,6,8-16,30-31,33-34,43H,3-5,7,17-24H2,(H,40,44)/t30-,31+,33-,34-/m0/s1 |
| InChIKey | LWLWQMPSZOQOBO-ZFINIAKPSA-N |
| XLogP | 6.94 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.11 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|