C36H41Cl3N2O6 — CID 6702424
tert-butyl (2S)-1-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6702424) has the molecular formula C36H41Cl3N2O6 and a molecular weight of 704.09 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6702424 |
| Molecular Formula | C36H41Cl3N2O6 |
| Molecular Weight | 704.09 g/mol |
| Exact Mass | 702.20 |
| IUPAC Name | tert-butyl (2S)-1-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)C(Cl)(Cl)Cl)cc2)O1 |
| InChI | InChI=1S/C36H41Cl3N2O6/c1-35(2,3)47-32(43)30-9-6-18-41(30)21-28-19-31(25-12-10-23(22-42)11-13-25)46-33(45-28)26-16-14-24(15-17-26)29-8-5-4-7-27(29)20-40-34(44)36(37,38)39/h4-5,7-8,10-17,28,30-31,33,42H,6,9,18-22H2,1-3H3,(H,40,44)/t28-,30+,31+,33+/m1/s1 |
| InChIKey | IRSOXLLDRIZENH-HZQVXLEISA-N |
| XLogP | 7.18 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.09 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|