C38H49N3O6 — CID 6685629
tert-butyl (2S)-1-[[(2S,4S,5R,6R)-2-[4-[2-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6685629) has the molecular formula C38H49N3O6 and a molecular weight of 643.83 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2S,4S,5R,6R)-2-[4-[2-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2S,4S,5R,6R)-2-[4-[2-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6685629 |
| Molecular Formula | C38H49N3O6 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | tert-butyl (2S)-1-[[(2S,4S,5R,6R)-2-[4-[2-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CCNC(=O)NCc1ccccc1-c1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CN3CCC[C@H]3C(=O)OC(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C38H49N3O6/c1-6-39-37(44)40-22-30-10-7-8-11-31(30)27-17-19-29(20-18-27)36-45-33(23-41-21-9-12-32(41)35(43)47-38(3,4)5)25(2)34(46-36)28-15-13-26(24-42)14-16-28/h7-8,10-11,13-20,25,32-34,36,42H,6,9,12,21-24H2,1-5H3,(H2,39,40,44)/t25-,32-,33+,34?,36+/m0/s1 |
| InChIKey | AHXPZPABNMIUEL-NVPAGNTCSA-N |
| XLogP | 6.26 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |