C42H43F5N2O6 — CID 4606039
tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 4606039) has the molecular formula C42H43F5N2O6 and a molecular weight of 766.80 g/mol. Its IUPAC name is tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 4606039 |
| Molecular Formula | C42H43F5N2O6 |
| Molecular Weight | 766.80 g/mol |
| Exact Mass | 766.30 |
| IUPAC Name | tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[3-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CC1C(CN2CCCC2C(=O)OC(C)(C)C)OC(c2ccc(-c3cccc(CNC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C42H43F5N2O6/c1-23-31(21-49-18-6-9-30(49)40(52)55-42(2,3)4)53-41(54-38(23)27-12-10-24(22-50)11-13-27)28-16-14-26(15-17-28)29-8-5-7-25(19-29)20-48-39(51)32-33(43)35(45)37(47)36(46)34(32)44/h5,7-8,10-17,19,23,30-31,38,41,50H,6,9,18,20-22H2,1-4H3,(H,48,51) |
| InChIKey | LHEGHPRYQSQIPQ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|