C40H41F5N2O4 — CID 4255469
N-[[3-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 4255469) has the molecular formula C40H41F5N2O4 and a molecular weight of 708.77 g/mol. Its IUPAC name is N-[[3-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[3-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 4255469 |
| Molecular Formula | C40H41F5N2O4 |
| Molecular Weight | 708.77 g/mol |
| Exact Mass | 708.30 |
| IUPAC Name | N-[[3-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC1C(CN2CCCCCCC2)OC(c2cccc(-c3cccc(CNC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)c2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C40H41F5N2O4/c1-24-31(22-47-17-5-3-2-4-6-18-47)50-40(51-38(24)27-15-13-25(23-48)14-16-27)30-12-8-11-29(20-30)28-10-7-9-26(19-28)21-46-39(49)32-33(41)35(43)37(45)36(44)34(32)42/h7-16,19-20,24,31,38,40,48H,2-6,17-18,21-23H2,1H3,(H,46,49) |
| InChIKey | LFRWACKRZUIFDX-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.77 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|