C37H41N3O4 — CID 6687596
N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 6687596) has the molecular formula C37H41N3O4 and a molecular weight of 591.75 g/mol. Its IUPAC name is N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6687596 |
| Molecular Formula | C37H41N3O4 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)c4cccnc4)c3)c2)O[C@H]1CN1CCCCC1 |
| InChI | InChI=1S/C37H41N3O4/c1-26-34(24-40-18-3-2-4-19-40)43-37(44-35(26)29-15-13-27(25-41)14-16-29)32-11-6-10-31(21-32)30-9-5-8-28(20-30)22-39-36(42)33-12-7-17-38-23-33/h5-17,20-21,23,26,34-35,37,41H,2-4,18-19,22,24-25H2,1H3,(H,39,42)/t26-,34+,35?,37+/m1/s1 |
| InChIKey | ZOYBGPQDBMATOH-SERZQCMPSA-N |
| XLogP | 6.45 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |