C35H32F5NO5S — CID 6687480
2,3,4,5,6-pentafluoro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6687480) has the molecular formula C35H32F5NO5S and a molecular weight of 673.70 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6687480 |
| Molecular Formula | C35H32F5NO5S |
| Molecular Weight | 673.70 g/mol |
| Exact Mass | 673.19 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C[C@@H]1[C@H](CSCCO)O[C@H](c2cccc(-c3cccc(CNC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H32F5NO5S/c1-19-26(18-47-13-12-42)45-35(46-33(19)22-10-8-20(17-43)9-11-22)25-7-3-6-24(15-25)23-5-2-4-21(14-23)16-41-34(44)27-28(36)30(38)32(40)31(39)29(27)37/h2-11,14-15,19,26,33,35,42-43H,12-13,16-18H2,1H3,(H,41,44)/t19-,26+,33+,35+/m1/s1 |
| InChIKey | YDTSBJWRQVPPKD-OIAYXNGMSA-N |
| XLogP | 6.99 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.70 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|