C36H44N2O6 — CID 6681803
[(2S)-1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate (PubChem CID 6681803) has the molecular formula C36H44N2O6 and a molecular weight of 600.76 g/mol. Its IUPAC name is [(2S)-1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6681803 |
| Molecular Formula | C36H44N2O6 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | [(2S)-1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C(=O)NCc1cccc(-c2ccc([C@H]3OC(c4ccc(CO)cc4)[C@@H](C)[C@@H](CN4CCCCC4)O3)cc2)c1 |
| InChI | InChI=1S/C36H44N2O6/c1-24-33(22-38-18-5-4-6-19-38)43-36(44-34(24)30-12-10-27(23-39)11-13-30)31-16-14-29(15-17-31)32-9-7-8-28(20-32)21-37-35(41)25(2)42-26(3)40/h7-17,20,24-25,33-34,36,39H,4-6,18-19,21-23H2,1-3H3,(H,37,41)/t24-,25-,33+,34?,36+/m0/s1 |
| InChIKey | PTPMLCORGLERQY-XBKJFFPLSA-N |
| XLogP | 5.69 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |