C44H57N3O4 — CID 6682738
1-(1-adamantyl)-3-[[3-[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6682738) has the molecular formula C44H57N3O4 and a molecular weight of 691.96 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[3-[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[3-[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6682738 |
| Molecular Formula | C44H57N3O4 |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.43 |
| IUPAC Name | 1-(1-adamantyl)-3-[[3-[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@H]1[C@@H](CN2CCCCCCC2)O[C@@H](c2ccc(-c3cccc(CNC(=O)NC45CC6CC(CC(C6)C4)C5)c3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C44H57N3O4/c1-30-40(28-47-18-5-3-2-4-6-19-47)50-42(51-41(30)37-12-10-31(29-48)11-13-37)38-16-14-36(15-17-38)39-9-7-8-32(23-39)27-45-43(49)46-44-24-33-20-34(25-44)22-35(21-33)26-44/h7-17,23,30,33-35,40-42,48H,2-6,18-22,24-29H2,1H3,(H2,45,46,49)/t30-,33?,34?,35?,40+,41+,42+,44?/m0/s1 |
| InChIKey | WTDNGKPRNRSMSJ-IRTBHKSHSA-N |
| XLogP | 8.67 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |