C38H43N3O5 — CID 6687678
1-benzyl-3-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6687678) has the molecular formula C38H43N3O5 and a molecular weight of 621.78 g/mol. Its IUPAC name is 1-benzyl-3-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6687678 |
| Molecular Formula | C38H43N3O5 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | 1-benzyl-3-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(-c3cccc(CNC(=O)NCc4ccccc4)c3)cc2)O[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C38H43N3O5/c1-27-35(25-41-18-20-44-21-19-41)45-37(46-36(27)32-12-10-29(26-42)11-13-32)33-16-14-31(15-17-33)34-9-5-8-30(22-34)24-40-38(43)39-23-28-6-3-2-4-7-28/h2-17,22,27,35-37,42H,18-21,23-26H2,1H3,(H2,39,40,43)/t27-,35+,36?,37+/m1/s1 |
| InChIKey | BIABLOFZGXUNMZ-CYQMTUHFSA-N |
| XLogP | 5.97 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |