C35H42N2O6 — CID 6690081
N-[[3-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6690081) has the molecular formula C35H42N2O6 and a molecular weight of 586.73 g/mol. Its IUPAC name is N-[[3-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6690081 |
| Molecular Formula | C35H42N2O6 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | N-[[3-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CN4CCC5(CC4)OCCO5)[C@@H](C)[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C35H42N2O6/c1-24-32(22-37-16-14-35(15-17-37)40-18-19-41-35)42-34(43-33(24)29-8-6-26(23-38)7-9-29)30-12-10-28(11-13-30)31-5-3-4-27(20-31)21-36-25(2)39/h3-13,20,24,32-34,38H,14-19,21-23H2,1-2H3,(H,36,39)/t24-,32+,33+,34+/m1/s1 |
| InChIKey | LQBYJYVGGPNROH-KSKMYWHUSA-N |
| XLogP | 5.11 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |