C33H40N2O5 — CID 6684326
[4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6684326) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6684326 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-6-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@H]1[C@@H](CN2CCC3(CC2)OCCO3)O[C@@H](c2ccc(-c3cccc(CN)c3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C33H40N2O5/c1-23-30(21-35-15-13-33(14-16-35)37-17-18-38-33)39-32(40-31(23)27-7-5-24(22-36)6-8-27)28-11-9-26(10-12-28)29-4-2-3-25(19-29)20-34/h2-12,19,23,30-32,36H,13-18,20-22,34H2,1H3/t23-,30+,31+,32+/m0/s1 |
| InChIKey | KSUVMKQYPFHOTH-RJTFWAQASA-N |
| XLogP | 4.93 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |