C41H42N2O7 — CID 6684386
2-[[3-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6684386) has the molecular formula C41H42N2O7 and a molecular weight of 674.79 g/mol. Its IUPAC name is 2-[[3-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6684386 |
| Molecular Formula | C41H42N2O7 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | 2-[[3-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CN2CCC3(CC2)OCCO3)O[C@@H](c2cccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C41H42N2O7/c1-27-36(25-42-18-16-41(17-19-42)47-20-21-48-41)49-40(50-37(27)30-14-12-28(26-44)13-15-30)33-9-5-8-32(23-33)31-7-4-6-29(22-31)24-43-38(45)34-10-2-3-11-35(34)39(43)46/h2-15,22-23,27,36-37,40,44H,16-21,24-26H2,1H3/t27-,36+,37+,40+/m0/s1 |
| InChIKey | FAZGDGNIFBXSKF-NODOWKNCSA-N |
| XLogP | 6.27 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|