C40H42N2O6 — CID 6683121
2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6683121) has the molecular formula C40H42N2O6 and a molecular weight of 646.78 g/mol. Its IUPAC name is 2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6683121 |
| Molecular Formula | C40H42N2O6 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | 2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | COC[C@@H]1CCCN1C[C@H]1O[C@@H](c2cccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)c2)O[C@@H](c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C40H42N2O6/c1-26-36(23-41-19-7-12-33(41)25-46-2)47-40(48-37(26)29-17-15-27(24-43)16-18-29)32-11-6-10-31(21-32)30-9-5-8-28(20-30)22-42-38(44)34-13-3-4-14-35(34)39(42)45/h3-6,8-11,13-18,20-21,26,33,36-37,40,43H,7,12,19,22-25H2,1-2H3/t26-,33-,36+,37+,40+/m0/s1 |
| InChIKey | ODXIPMPZASMIRP-LLAXCRCCSA-N |
| XLogP | 6.54 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|