C50H52N4O5 — CID 6691469
1-[[3-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6691469) has the molecular formula C50H52N4O5 and a molecular weight of 788.99 g/mol. Its IUPAC name is 1-[[3-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[[3-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6691469 |
| Molecular Formula | C50H52N4O5 |
| Molecular Weight | 788.99 g/mol |
| Exact Mass | 788.39 |
| IUPAC Name | 1-[[3-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(-c3cccc(CNC(=O)Nc4ccc(Oc5ccccc5)cc4)c3)cc2)O[C@H]1CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C50H52N4O5/c1-36-47(34-54-29-27-53(28-30-54)33-37-9-4-2-5-10-37)58-49(59-48(36)41-17-15-38(35-55)16-18-41)42-21-19-40(20-22-42)43-12-8-11-39(31-43)32-51-50(56)52-44-23-25-46(26-24-44)57-45-13-6-3-7-14-45/h2-26,31,36,47-49,55H,27-30,32-35H2,1H3,(H2,51,52,56)/t36-,47+,48?,49+/m1/s1 |
| InChIKey | OTVALJPIAFBNDN-JMNMYAPWSA-N |
| XLogP | 9.57 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.99 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |