C42H49N3O7 — CID 6685586
tert-butyl (2S)-1-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6685586) has the molecular formula C42H49N3O7 and a molecular weight of 707.87 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6685586 |
| Molecular Formula | C42H49N3O7 |
| Molecular Weight | 707.87 g/mol |
| Exact Mass | 707.36 |
| IUPAC Name | tert-butyl (2S)-1-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)Nc3ccc(Oc4ccccc4)cc3)cc2)O[C@@H]1CN1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H49N3O7/c1-28-37(26-45-24-8-11-36(45)39(47)52-42(2,3)4)50-40(51-38(28)31-16-14-30(27-46)15-17-31)32-18-12-29(13-19-32)25-43-41(48)44-33-20-22-35(23-21-33)49-34-9-6-5-7-10-34/h5-7,9-10,12-23,28,36-38,40,46H,8,11,24-27H2,1-4H3,(H2,43,44,48)/t28-,36-,37+,38?,40+/m0/s1 |
| InChIKey | MZMSDRBCGGGTCD-RJYJXDHJSA-N |
| XLogP | 7.89 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.87 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |