C26H31Cl3N2O4 — CID 6698753
2,2,2-trichloro-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6698753) has the molecular formula C26H31Cl3N2O4 and a molecular weight of 541.90 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6698753 |
| Molecular Formula | C26H31Cl3N2O4 |
| Molecular Weight | 541.90 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccc([C@H]2O[C@@H](CN3CCCCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H31Cl3N2O4/c27-26(28,29)25(33)30-15-18-4-10-21(11-5-18)24-34-22(16-31-12-2-1-3-13-31)14-23(35-24)20-8-6-19(17-32)7-9-20/h4-11,22-24,32H,1-3,12-17H2,(H,30,33)/t22-,23+,24+/m1/s1 |
| InChIKey | ZYYRALSXHSPRAT-SGNDLWITSA-N |
| XLogP | 5.20 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|