C38H40Cl3N3O4 — CID 6702512
N-[[3-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide (PubChem CID 6702512) has the molecular formula C38H40Cl3N3O4 and a molecular weight of 709.11 g/mol. Its IUPAC name is N-[[3-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[[3-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 6702512 |
| Molecular Formula | C38H40Cl3N3O4 |
| Molecular Weight | 709.11 g/mol |
| Exact Mass | 707.21 |
| IUPAC Name | N-[[3-[4-[(2R,4R,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide |
| SMILES | O=C(NCc1cccc(-c2ccc([C@H]3O[C@@H](CN4CCN(Cc5ccccc5)CC4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C38H40Cl3N3O4/c39-38(40,41)37(46)42-23-29-7-4-8-33(21-29)30-13-15-32(16-14-30)36-47-34(22-35(48-36)31-11-9-28(26-45)10-12-31)25-44-19-17-43(18-20-44)24-27-5-2-1-3-6-27/h1-16,21,34-36,45H,17-20,22-26H2,(H,42,46)/t34-,35+,36+/m1/s1 |
| InChIKey | GKTKEGPGHRDYFZ-SBPNQFBHSA-N |
| XLogP | 7.20 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.11 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|