C38H39Cl3N2O6 — CID 6703062
2,2,2-trichloro-N-[[3-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6703062) has the molecular formula C38H39Cl3N2O6 and a molecular weight of 726.10 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6703062 |
| Molecular Formula | C38H39Cl3N2O6 |
| Molecular Weight | 726.10 g/mol |
| Exact Mass | 724.19 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | COc1cc2c(cc1OC)CN(C[C@H]1C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(-c4cccc(CNC(=O)C(Cl)(Cl)Cl)c4)cc3)O1)CC2 |
| InChI | InChI=1S/C38H39Cl3N2O6/c1-46-34-17-30-14-15-43(21-31(30)18-35(34)47-2)22-32-19-33(27-8-6-24(23-44)7-9-27)49-36(48-32)28-12-10-26(11-13-28)29-5-3-4-25(16-29)20-42-37(45)38(39,40)41/h3-13,16-18,32-33,36,44H,14-15,19-23H2,1-2H3,(H,42,45)/t32-,33+,36+/m1/s1 |
| InChIKey | BCTLOYUXNVYEEA-MENXEMIHSA-N |
| XLogP | 7.45 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.10 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|