C33H41N3O6 — CID 6697558
1-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-ethylurea (PubChem CID 6697558) has the molecular formula C33H41N3O6 and a molecular weight of 575.71 g/mol. Its IUPAC name is 1-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-ethylurea.
| Compound Name | 1-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-ethylurea |
|---|---|
| PubChem CID | 6697558 |
| Molecular Formula | C33H41N3O6 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | 1-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-ethylurea |
| SMILES | CCNC(=O)NCc1ccc([C@@H]2O[C@H](CN3CCc4cc(OC)c(OC)cc4C3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C33H41N3O6/c1-4-34-33(38)35-18-22-5-11-25(12-6-22)32-41-28(17-29(42-32)24-9-7-23(21-37)8-10-24)20-36-14-13-26-15-30(39-2)31(40-3)16-27(26)19-36/h5-12,15-16,28-29,32,37H,4,13-14,17-21H2,1-3H3,(H2,34,35,38)/t28-,29+,32+/m0/s1 |
| InChIKey | ISILVCWTEVJIAO-NPLMNSEMSA-N |
| XLogP | 4.62 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |