C34H41N3O8 — CID 6707083
ethyl 2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6707083) has the molecular formula C34H41N3O8 and a molecular weight of 619.71 g/mol. Its IUPAC name is ethyl 2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6707083 |
| Molecular Formula | C34H41N3O8 |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | ethyl 2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@@H]2O[C@H](CN3CCc4cc(OC)c(OC)cc4C3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C34H41N3O8/c1-4-43-32(39)18-35-34(40)36-27-11-9-24(10-12-27)33-44-28(17-29(45-33)23-7-5-22(21-38)6-8-23)20-37-14-13-25-15-30(41-2)31(42-3)16-26(25)19-37/h5-12,15-16,28-29,33,38H,4,13-14,17-21H2,1-3H3,(H2,35,36,40)/t28-,29+,33+/m0/s1 |
| InChIKey | OSJPFTDULOODFZ-FISMMAAMSA-N |
| XLogP | 4.48 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |