C40H45N3O8 — CID 6707084
methyl (2S)-2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 6707084) has the molecular formula C40H45N3O8 and a molecular weight of 695.81 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6707084 |
| Molecular Formula | C40H45N3O8 |
| Molecular Weight | 695.81 g/mol |
| Exact Mass | 695.32 |
| IUPAC Name | methyl (2S)-2-[[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1ccc([C@@H]2O[C@H](CN3CCc4cc(OC)c(OC)cc4C3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C40H45N3O8/c1-47-36-20-30-17-18-43(23-31(30)21-37(36)48-2)24-33-22-35(28-11-9-27(25-44)10-12-28)51-39(50-33)29-13-15-32(16-14-29)41-40(46)42-34(38(45)49-3)19-26-7-5-4-6-8-26/h4-16,20-21,33-35,39,44H,17-19,22-25H2,1-3H3,(H2,41,42,46)/t33-,34-,35+,39+/m0/s1 |
| InChIKey | VFWQSIARRPIMJL-ITHGDKCPSA-N |
| XLogP | 5.71 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |