C36H38N2O6 — CID 6697524
N-[3-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6697524) has the molecular formula C36H38N2O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is N-[3-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | N-[3-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6697524 |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | N-[3-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | COc1cc2c(cc1OC)CN(C[C@@H]1C[C@H](c3ccc(CO)cc3)O[C@H](c3cccc(NC(=O)c4ccccc4)c3)O1)CC2 |
| InChI | InChI=1S/C36H38N2O6/c1-41-33-18-27-15-16-38(21-29(27)19-34(33)42-2)22-31-20-32(25-13-11-24(23-39)12-14-25)44-36(43-31)28-9-6-10-30(17-28)37-35(40)26-7-4-3-5-8-26/h3-14,17-19,31-32,36,39H,15-16,20-23H2,1-2H3,(H,37,40)/t31-,32+,36+/m0/s1 |
| InChIKey | OJGKTSBJBDRNHC-MFNWSBMRSA-N |
| XLogP | 6.05 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |