C43H44N2O6 — CID 6697567
N-[[3-[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6697567) has the molecular formula C43H44N2O6 and a molecular weight of 684.83 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6697567 |
| Molecular Formula | C43H44N2O6 |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | N-[[3-[4-[(2S,4S,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | COc1cc2c(cc1OC)CN(C[C@@H]1C[C@H](c3ccc(CO)cc3)O[C@H](c3ccc(-c4cccc(CNC(=O)c5ccccc5)c4)cc3)O1)CC2 |
| InChI | InChI=1S/C43H44N2O6/c1-48-40-22-36-19-20-45(26-37(36)23-41(40)49-2)27-38-24-39(32-13-11-29(28-46)12-14-32)51-43(50-38)34-17-15-31(16-18-34)35-10-6-7-30(21-35)25-44-42(47)33-8-4-3-5-9-33/h3-18,21-23,38-39,43,46H,19-20,24-28H2,1-2H3,(H,44,47)/t38-,39+,43+/m0/s1 |
| InChIKey | BDGLXMCMBZGYDU-WARCWCLLSA-N |
| XLogP | 7.40 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |